CAS 104199-82-8 appears in our catalog under these names: Boc–D–Asn–ONp, Boc-D-Asn-ONp, Boc-D-Asn-ONp 98%, (R)-4-Nitrophenyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 50g, 1g.
(4-nitrophenyl) (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 104199-82-8) is a chemical compound with the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. IUPAC name: (4-nitrophenyl) (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: IAPXDJMULQXGDD-LLVKDONJSA-N.
| Molecular formula | C15H19N3O7 |
|---|---|
| Molecular weight | 353.33 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | IAPXDJMULQXGDD-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)N)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)