CAS 38605-58-2 appears in our catalog under these names: Boc-Asn-o-nitrophenyl ester, Boc–Asn–o–nitrophenyl ester. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 50g, 100g.
(2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 38605-58-2) is a chemical compound with the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. IUPAC name: (2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: KSOSHRILCLONAA-VIFPVBQESA-N.
| Molecular formula | C15H19N3O7 |
|---|---|
| Molecular weight | 353.33 g/mol |
| IUPAC name | (2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | KSOSHRILCLONAA-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)