CAS 1042-42-8 appears in our catalog under these names: Carcainium chloride, 98%, QX 572, >95% (HPLC), Carcainium chloride/ 99.89% (existing batch purity), Carcainium chloride, Carcainium (chloride), 99.47%. Offered by: AmBeed, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 10mg, 1mg, 25mg, 5mg, 50mg.
Bis(2-anilino-2-oxoethyl)-dimethylazanium chloride (CAS 1042-42-8) is a chemical compound with the molecular formula C18H22ClN3O2 and a molecular weight of 347.8 g/mol. IUPAC name: bis(2-anilino-2-oxoethyl)-dimethylazanium chloride. InChIKey: YGCONRRHHMKQRL-UHFFFAOYSA-N.
| Molecular formula | C18H22ClN3O2 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | bis(2-anilino-2-oxoethyl)-dimethylazanium chloride |
| InChIKey | YGCONRRHHMKQRL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CC(=O)NC1=CC=CC=C1)CC(=O)NC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)