CAS 1235972-74-3 is the registry number for 7-Chloro-4-(4-BOC-piperazino)quinoline, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
Tert-butyl 4-(7-chloroquinolin-4-yl)piperazine-1-carboxylate (CAS 1235972-74-3) is a chemical compound with the molecular formula C18H22ClN3O2 and a molecular weight of 347.8 g/mol. IUPAC name: tert-butyl 4-(7-chloroquinolin-4-yl)piperazine-1-carboxylate. InChIKey: MJCHTXDEKYWEOM-UHFFFAOYSA-N.
| Molecular formula | C18H22ClN3O2 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | tert-butyl 4-(7-chloroquinolin-4-yl)piperazine-1-carboxylate |
| InChIKey | MJCHTXDEKYWEOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C3C=CC(=CC3=NC=C2)Cl |
Computed by PubChem (NCBI)