CAS 104204-91-3 is the registry number for 6–Fluoro–1–isopropyl–3,4–dihydronaphthalen–2(1H)–one. Offered by: GLPBio. Available pack sizes: 100mg.
6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-one (CAS 104204-91-3) is a chemical compound with the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. IUPAC name: 6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-one. InChIKey: DEGWMPOIXJTKLT-UHFFFAOYSA-N.
| Molecular formula | C13H15FO |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | DEGWMPOIXJTKLT-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)CCC2=C1C=CC(=C2)F |
Computed by PubChem (NCBI)