CAS 85014-02-4 is the registry number for Cyclohexyl 4-fluorophenyl ketone, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Cyclohexyl-(4-fluorophenyl)methanone (CAS 85014-02-4) is a chemical compound with the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. IUPAC name: cyclohexyl-(4-fluorophenyl)methanone. InChIKey: QDAMRMWTBRLMEG-UHFFFAOYSA-N.
| Molecular formula | C13H15FO |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | cyclohexyl-(4-fluorophenyl)methanone |
| InChIKey | QDAMRMWTBRLMEG-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)