CAS 104216-91-3 appears in our catalog under these names: 5-Methyl-2-isopropoxybenzoic acid, 95%, 2-Isopropoxy-5-methylbenzoic acid, 98%, 5-Methyl-2-isopropoxybenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g.
5-methyl-2-propan-2-yloxybenzoic acid (CAS 104216-91-3) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 5-methyl-2-propan-2-yloxybenzoic acid. InChIKey: GWSJKYZJQFWGCW-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-methyl-2-propan-2-yloxybenzoic acid |
| InChIKey | GWSJKYZJQFWGCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(C)C)C(=O)O |
Computed by PubChem (NCBI)