CAS 1042167-64-5 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(3-nitrophenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3-nitrophenyl)-1-(4-phenylphenyl)prop-2-en-1-one (CAS 1042167-64-5) is a chemical compound with the molecular formula C21H15NO3 and a molecular weight of 329.3 g/mol. IUPAC name: (E)-3-(3-nitrophenyl)-1-(4-phenylphenyl)prop-2-en-1-one. InChIKey: KUDUGKHMTPCYCN-NTEUORMPSA-N.
| Molecular formula | C21H15NO3 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (E)-3-(3-nitrophenyl)-1-(4-phenylphenyl)prop-2-en-1-one |
| InChIKey | KUDUGKHMTPCYCN-NTEUORMPSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)/C=C/C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)