CAS 81-48-1 appears in our catalog under these names: 1-Hydroxy-4-(p-tolylamino)anthracene-9,10-dione, Solvent violet 13, 97%, Solvent Violet 13, Quinizarin Blue, >90.0%(HPLC), Alizurol purple 97%. Offered by: TRC, Combi-blocks, Dr. Ehrenstorfer, TCI, Ambeed. Available pack sizes: 10g, 1g, 5g, 1kg, 500g, 100g, 25g, 100mg.
1-hydroxy-4-(4-methylanilino)anthracene-9,10-dione (CAS 81-48-1) is a chemical compound with the molecular formula C21H15NO3 and a molecular weight of 329.3 g/mol. IUPAC name: 1-hydroxy-4-(4-methylanilino)anthracene-9,10-dione. InChIKey: LJFWQNJLLOFIJK-UHFFFAOYSA-N.
| Molecular formula | C21H15NO3 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 1-hydroxy-4-(4-methylanilino)anthracene-9,10-dione |
| InChIKey | LJFWQNJLLOFIJK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C3C(=C(C=C2)O)C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)