Products 104224-62-6
CAS 104224-62-6 appears in our catalog under these names: 3-(1-Adamantyl)-4-methoxybenzoic acid, 95%, 3-(Adamantan-1-yl)-4-methoxybenzoic acid, 97%, 4-Methoxy-3-tricyclo[3.3.1.13,7]dec-1-ylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 100mg.
3-(1-adamantyl)-4-methoxybenzoic acid (CAS 104224-62-6) is a chemical compound with the molecular formula C18H22O3 and a molecular weight of 286.4 g/mol. IUPAC name: 3-(1-adamantyl)-4-methoxybenzoic acid. InChIKey: RWZRMETXJWTWQW-UHFFFAOYSA-N.
| Molecular formula | C18H22O3 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 3-(1-adamantyl)-4-methoxybenzoic acid |
| InChIKey | RWZRMETXJWTWQW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)
Synonyms:
3-(1-adamantyl)-4-methoxybenzoic acid, 3-(adamantan-1-yl)-4-methoxybenzoic acid, 4-Methoxy-3-tricyclo[3.3.1.13,7]dec-1-ylbenzoic acid, 3-adamantanyl-4-methoxybenzoic acid, benzoic acid, 4-methoxy-3-tricyclo[3.3.1.1~3,7~]dec-1-yl-, 4-methoxy-3-(tricyclo[3.3.1.1~3,7~]dec-1-yl)benzoic acid, 3-(1-Admantyl)-4-methoxybenzoic acid, 3-adamantan-1-yl-4-methoxybenzoic acid, 3-(1-adamantyl)-4-methoxy benzoic acid, 3-(1-adamantyl)-4-methoxy-benzoic acid