Products 56531-56-7
CAS 56531-56-7 appears in our catalog under these names: 3-(4-Methoxyphenyl)adamantane-1-carboxylic acid, 95%, 3-(4-Methoxyphenyl)adamantane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-methoxyphenyl)adamantane-1-carboxylic acid (CAS 56531-56-7) is a chemical compound with the molecular formula C18H22O3 and a molecular weight of 286.4 g/mol. IUPAC name: 3-(4-methoxyphenyl)adamantane-1-carboxylic acid. InChIKey: WFABACNPVFIEPX-UHFFFAOYSA-N.
| Molecular formula | C18H22O3 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)adamantane-1-carboxylic acid |
| InChIKey | WFABACNPVFIEPX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)(C3)C(=O)O |
Computed by PubChem (NCBI)