CAS 104226-19-9 is the registry number for 3-((4-(Bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
3-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]propan-1-ol (CAS 104226-19-9) is a chemical compound with the molecular formula C13H21N3O5 and a molecular weight of 299.32 g/mol. IUPAC name: 3-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]propan-1-ol. InChIKey: YHSOWKGIYXECIF-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O5 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 3-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]propan-1-ol |
| InChIKey | YHSOWKGIYXECIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N(CCO)CCO)[N+](=O)[O-])NCCCO |
Computed by PubChem (NCBI)