CAS 1449117-74-1 appears in our catalog under these names: 1-TERT-BUTYL 3-ETHYL 4-UREIDO-1H-PYRROLE-1,3(2H,5H)-DICARBOXYLATE, 98%, 98%, 1-tert-Butyl 3-ethyl 4-ureido-1H-pyrrole-1,3(2H,5H)-dicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O-ethyl 4-(carbamoylamino)-2,5-dihydropyrrole-1,3-dicarboxylate (CAS 1449117-74-1) is a chemical compound with the molecular formula C13H21N3O5 and a molecular weight of 299.32 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-(carbamoylamino)-2,5-dihydropyrrole-1,3-dicarboxylate. InChIKey: MJAHHFLAKJFTHQ-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O5 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-(carbamoylamino)-2,5-dihydropyrrole-1,3-dicarboxylate |
| InChIKey | MJAHHFLAKJFTHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CN(C1)C(=O)OC(C)(C)C)NC(=O)N |
Computed by PubChem (NCBI)