CAS 104227-86-3 appears in our catalog under these names: 6-Deoxypenciclovir, >95% (HPLC), 6–Deoxypenciclovir, 6-Deoxypenciclovir, 2-(2-(2-Amino-9H-purin-9-yl)ethyl)propane-1,3-diol, 98%, 98%, 6-Deoxypenciclovir, 99.83%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 1mg, 5mg, 2mg, 50mg, 250mg.
2-[2-(2-aminopurin-9-yl)ethyl]propane-1,3-diol (CAS 104227-86-3) is a chemical compound with the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. IUPAC name: 2-[2-(2-aminopurin-9-yl)ethyl]propane-1,3-diol. InChIKey: WJOWACPJSFGNRM-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O2 |
|---|---|
| Molecular weight | 237.26 g/mol |
| IUPAC name | 2-[2-(2-aminopurin-9-yl)ethyl]propane-1,3-diol |
| InChIKey | WJOWACPJSFGNRM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C=N2)CCC(CO)CO |
Computed by PubChem (NCBI)