Products 23120-19-6
CAS 23120-19-6 is the registry number for N4-Cyclohexyl-5-nitropyrimidine-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-cyclohexyl-5-nitropyrimidine-4,6-diamine (CAS 23120-19-6) is a chemical compound with the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. IUPAC name: 4-N-cyclohexyl-5-nitropyrimidine-4,6-diamine. InChIKey: OWXVKTCIXVBWKL-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O2 |
|---|---|
| Molecular weight | 237.26 g/mol |
| IUPAC name | 4-N-cyclohexyl-5-nitropyrimidine-4,6-diamine |
| InChIKey | OWXVKTCIXVBWKL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=NC=NC(=C2[N+](=O)[O-])N |
Computed by PubChem (NCBI)