Products 1042435-45-9

CAS 1042435-45-9 is the registry number for 14-Oxo-4,7,10,13-tetraoxahexadec-15-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]propanoic acid (CAS 1042435-45-9) is a chemical compound with the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. IUPAC name: 3-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: IILBKNAEUHKVQM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O7
Molecular weight276.28 g/mol
IUPAC name3-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]propanoic acid
InChIKeyIILBKNAEUHKVQM-UHFFFAOYSA-N
SMILESC=CC(=O)OCCOCCOCCOCCC(=O)O

Computed by PubChem (NCBI)