Products 16496-37-0

CAS 16496-37-0 is the registry number for Triethyl Isocitrate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 500mg, 0,25g, 0,1g, 0,5g.

Structural formula: {0} (CAS {1})

Triethyl 1-hydroxypropane-1,2,3-tricarboxylate (CAS 16496-37-0) is a chemical compound with the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. IUPAC name: triethyl 1-hydroxypropane-1,2,3-tricarboxylate. InChIKey: BFSUGKVPVMLOQN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O7
Molecular weight276.28 g/mol
IUPAC nametriethyl 1-hydroxypropane-1,2,3-tricarboxylate
InChIKeyBFSUGKVPVMLOQN-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(C(=O)OCC)O)C(=O)OCC

Computed by PubChem (NCBI)