Products 1042651-11-5
CAS 1042651-11-5 is the registry number for 4-(Piperazine-1-carbonyl)-2,3-dihydro-1H-imidazol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(piperazine-1-carbonyl)-1,3-dihydroimidazol-2-one (CAS 1042651-11-5) is a chemical compound with the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. IUPAC name: 4-(piperazine-1-carbonyl)-1,3-dihydroimidazol-2-one. InChIKey: GYQUWAASFPLFRT-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O2 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 4-(piperazine-1-carbonyl)-1,3-dihydroimidazol-2-one |
| InChIKey | GYQUWAASFPLFRT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CNC(=O)N2 |
Computed by PubChem (NCBI)