CAS 1042722-41-7 appears in our catalog under these names: Methyl 3–bromo–2–(bromomethyl)–4,5–dimethoxybenzoate, Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate, 95%, 95%, METHYL 3-BROMO-2-(BROMOMETHYL)-4,5-DIMETHOXYBENZOATE, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate (CAS 1042722-41-7) is a chemical compound with the molecular formula C11H12Br2O4 and a molecular weight of 368.02 g/mol. IUPAC name: methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate. InChIKey: GQHPLAGWOKBJEH-UHFFFAOYSA-N.
| Molecular formula | C11H12Br2O4 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | methyl 3-bromo-2-(bromomethyl)-4,5-dimethoxybenzoate |
| InChIKey | GQHPLAGWOKBJEH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)OC)CBr)Br)OC |
Computed by PubChem (NCBI)