CAS 144585-08-0 is the registry number for 2,2-Dibromo-1-(3,4,5-trimethoxyphenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3,4,5-trimethoxyphenyl)ethanone (CAS 144585-08-0) is a chemical compound with the molecular formula C11H12Br2O4 and a molecular weight of 368.02 g/mol. IUPAC name: 2,2-dibromo-1-(3,4,5-trimethoxyphenyl)ethanone. InChIKey: NGDYWIUWKYTQHR-UHFFFAOYSA-N.
| Molecular formula | C11H12Br2O4 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 2,2-dibromo-1-(3,4,5-trimethoxyphenyl)ethanone |
| InChIKey | NGDYWIUWKYTQHR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C(Br)Br |
Computed by PubChem (NCBI)