CAS 10435-55-9 appears in our catalog under these names: 4-Ethoxy-2-hydroxybenzoic acid, 95%, 4-Ethoxysalicylic acid, 4-Ethoxy-2-hydroxybenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 250mg.
4-ethoxy-2-hydroxybenzoic acid (CAS 10435-55-9) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 4-ethoxy-2-hydroxybenzoic acid. InChIKey: DVZPQHRWOUXUPU-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 4-ethoxy-2-hydroxybenzoic acid |
| InChIKey | DVZPQHRWOUXUPU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(=O)O)O |
Computed by PubChem (NCBI)