CAS 10437-44-2 appears in our catalog under these names: 2,6-Di-tert-butyl-4-(dimethylamino)phenol, 98%, Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2,6-ditert-butyl-4-(dimethylamino)phenol (CAS 10437-44-2) is a chemical compound with the molecular formula C16H27NO and a molecular weight of 249.39 g/mol. IUPAC name: 2,6-ditert-butyl-4-(dimethylamino)phenol. InChIKey: XHAYUUAFYPMOHE-UHFFFAOYSA-N.
| Molecular formula | C16H27NO |
|---|---|
| Molecular weight | 249.39 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(dimethylamino)phenol |
| InChIKey | XHAYUUAFYPMOHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)N(C)C |
Computed by PubChem (NCBI)