CAS 1212938-91-4 is the registry number for (R)-2-Amino-2-(3,5-di-tert-butylphenyl)ethanol, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g.
(2R)-2-amino-2-(3,5-ditert-butylphenyl)ethanol (CAS 1212938-91-4) is a chemical compound with the molecular formula C16H27NO and a molecular weight of 249.39 g/mol. IUPAC name: (2R)-2-amino-2-(3,5-ditert-butylphenyl)ethanol. InChIKey: GODKSIZLEOJZHJ-AWEZNQCLSA-N.
| Molecular formula | C16H27NO |
|---|---|
| Molecular weight | 249.39 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,5-ditert-butylphenyl)ethanol |
| InChIKey | GODKSIZLEOJZHJ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)[C@H](CO)N)C(C)(C)C |
Computed by PubChem (NCBI)