CAS 104393-94-4 is the registry number for (1R,2R,3R,5S)-2,6,6-Trimethylbicyclo(3.1.1)heptan-3-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(1R,2R,3R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride (CAS 104393-94-4) is a chemical compound with the molecular formula C10H20ClN and a molecular weight of 189.72 g/mol. IUPAC name: (1R,2R,3R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride. InChIKey: FJDRRWMHEAHOSA-LXZWUTDNSA-N.
| Molecular formula | C10H20ClN |
|---|---|
| Molecular weight | 189.72 g/mol |
| IUPAC name | (1R,2R,3R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine;hydrochloride |
| InChIKey | FJDRRWMHEAHOSA-LXZWUTDNSA-N |
| SMILES | C[C@@H]1[C@H]2C[C@H](C2(C)C)C[C@H]1N.Cl |
Computed by PubChem (NCBI)