Products 1044-49-1
CAS 1044-49-1 appears in our catalog under these names: bis(4-nitrophenyl)-1,3,4-oxadiazole, 98%+,RG, 2,5-Bis(4-nitrophenyl)-1,3,4-oxadiazole, 98%+,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-bis(4-nitrophenyl)-1,3,4-oxadiazole (CAS 1044-49-1) is a chemical compound with the molecular formula C14H8N4O5 and a molecular weight of 312.24 g/mol. IUPAC name: 2,5-bis(4-nitrophenyl)-1,3,4-oxadiazole. InChIKey: NXVIYWNQRSLRGX-UHFFFAOYSA-N.
| Molecular formula | C14H8N4O5 |
|---|---|
| Molecular weight | 312.24 g/mol |
| IUPAC name | 2,5-bis(4-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | NXVIYWNQRSLRGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)