Products 1044566-24-6
CAS 1044566-24-6 is the registry number for Galectin-8-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4S,5S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate (CAS 1044566-24-6) is a chemical compound with the molecular formula C15H20O7 and a molecular weight of 312.31 g/mol. IUPAC name: [(2R,3S,4S,5S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate. InChIKey: AUMNNPRVJYOFGH-HYFYGGESSA-N.
| Molecular formula | C15H20O7 |
|---|---|
| Molecular weight | 312.31 g/mol |
| IUPAC name | [(2R,3S,4S,5S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate |
| InChIKey | AUMNNPRVJYOFGH-HYFYGGESSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2[C@H]([C@H](O[C@H]([C@H]2O)OC)CO)O |
Computed by PubChem (NCBI)