CAS 1044695-85-3 appears in our catalog under these names: 1-(4-tert-Butylphenyl)ethane-1,2-diol, 95%, 1-(4-tert-Butylphenyl)ethane-1,2-diol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(4-tert-butylphenyl)ethane-1,2-diol (CAS 1044695-85-3) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 1-(4-tert-butylphenyl)ethane-1,2-diol. InChIKey: NNPXCFIPWDBGNX-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)ethane-1,2-diol |
| InChIKey | NNPXCFIPWDBGNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(CO)O |
Computed by PubChem (NCBI)