Products 1044870-65-6
CAS 1044870-65-6 is the registry number for MR2938. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 1 mg.
5,7-dimethoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-3H-quinazolin-4-one (CAS 1044870-65-6) is a chemical compound with the molecular formula C21H24N4O3 and a molecular weight of 380.4 g/mol. IUPAC name: 5,7-dimethoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-3H-quinazolin-4-one. InChIKey: RVCUXKFESITCJF-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O3 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-3H-quinazolin-4-one |
| InChIKey | RVCUXKFESITCJF-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C3=NC4=C(C(=CC(=C4)OC)OC)C(=O)N3 |
Computed by PubChem (NCBI)