CAS 878745-39-2 is the registry number for tert-Butyl (4-methyl-3-((3-methyl-4-oxo-3,4-dihydroquinazolin-6-yl)amino)phenyl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamate (CAS 878745-39-2) is a chemical compound with the molecular formula C21H24N4O3 and a molecular weight of 380.4 g/mol. IUPAC name: tert-butyl N-[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamate. InChIKey: VQNLQGIXUAAUFO-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O3 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | tert-butyl N-[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamate |
| InChIKey | VQNLQGIXUAAUFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OC(C)(C)C)NC2=CC3=C(C=C2)N=CN(C3=O)C |
Computed by PubChem (NCBI)