CAS 1045283-48-4 appears in our catalog under these names: 2-((2-Fluorophenoxy)methyl)thiazole-4-carboxylic acid, 2-((2-Fluorophenoxy)methyl)thiazole-4-carboxylic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid (CAS 1045283-48-4) is a chemical compound with the molecular formula C11H8FNO3S and a molecular weight of 253.25 g/mol. IUPAC name: 2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: ZJQHFPNNTRJURQ-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3S |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | ZJQHFPNNTRJURQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)