CAS 870554-59-9 appears in our catalog under these names: 3-[2-(4-Fluorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione, 95%, 3-(2-(4-FLuorophenyl)-2-oxoethyl)-1,3-thiazolidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (CAS 870554-59-9) is a chemical compound with the molecular formula C11H8FNO3S and a molecular weight of 253.25 g/mol. IUPAC name: 3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione. InChIKey: LIFONRUPZVRTSR-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3S |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 3-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | LIFONRUPZVRTSR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)