CAS 1045862-10-9 is the registry number for N-(2-Iodophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CAS 1045862-10-9) is a chemical compound with the molecular formula C11H12IN3O2S and a molecular weight of 377.20 g/mol. IUPAC name: N-(2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide. InChIKey: KCPUARCWUWTGIZ-UHFFFAOYSA-N.
| Molecular formula | C11H12IN3O2S |
|---|---|
| Molecular weight | 377.20 g/mol |
| IUPAC name | N-(2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | KCPUARCWUWTGIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)NC2=CC=CC=C2I |
Computed by PubChem (NCBI)