CAS 2287342-45-2 is the registry number for 4-(6-Iodo-1H-benzo[d][1,2,3]triazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-iodobenzotriazol-1-yl)thiane 1,1-dioxide (CAS 2287342-45-2) is a chemical compound with the molecular formula C11H12IN3O2S and a molecular weight of 377.20 g/mol. IUPAC name: 4-(6-iodobenzotriazol-1-yl)thiane 1,1-dioxide. InChIKey: JBVJXRZDEPRBBL-UHFFFAOYSA-N.
| Molecular formula | C11H12IN3O2S |
|---|---|
| Molecular weight | 377.20 g/mol |
| IUPAC name | 4-(6-iodobenzotriazol-1-yl)thiane 1,1-dioxide |
| InChIKey | JBVJXRZDEPRBBL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C3=C(C=CC(=C3)I)N=N2 |
Computed by PubChem (NCBI)