CAS 1046051-19-7 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(3-chlorophenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3-chlorophenyl)-1-(4-phenylphenyl)prop-2-en-1-one (CAS 1046051-19-7) is a chemical compound with the molecular formula C21H15ClO and a molecular weight of 318.8 g/mol. IUPAC name: (E)-3-(3-chlorophenyl)-1-(4-phenylphenyl)prop-2-en-1-one. InChIKey: YHFXVZDDZVJFAN-NTEUORMPSA-N.
| Molecular formula | C21H15ClO |
|---|---|
| Molecular weight | 318.8 g/mol |
| IUPAC name | (E)-3-(3-chlorophenyl)-1-(4-phenylphenyl)prop-2-en-1-one |
| InChIKey | YHFXVZDDZVJFAN-NTEUORMPSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)/C=C/C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)