Products 1567814-82-7

CAS 1567814-82-7 is the registry number for 10-Chloro-7,7-dimethyl-7H-benzo[b]fluoreno[3,4-d]furan, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzofuran (CAS 1567814-82-7) is a chemical compound with the molecular formula C21H15ClO and a molecular weight of 318.8 g/mol. IUPAC name: 10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzofuran. InChIKey: DKNYTXIXMCTZQC-UHFFFAOYSA-N.

Identity
Molecular formulaC21H15ClO
Molecular weight318.8 g/mol
IUPAC name10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzofuran
InChIKeyDKNYTXIXMCTZQC-UHFFFAOYSA-N
SMILESCC1(C2=C(C=C(C=C2)Cl)C3=C1C=CC4=C3OC5=CC=CC=C45)C

Computed by PubChem (NCBI)