CAS 1046118-65-3 is the registry number for 5-(3-Bromo-4-fluorophenyl)imidazolidine-2,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(3-bromo-4-fluorophenyl)imidazolidine-2,4-dione (CAS 1046118-65-3) is a chemical compound with the molecular formula C9H6BrFN2O2 and a molecular weight of 273.06 g/mol. IUPAC name: 5-(3-bromo-4-fluorophenyl)imidazolidine-2,4-dione. InChIKey: WCBAZPKSUHCCHB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 5-(3-bromo-4-fluorophenyl)imidazolidine-2,4-dione |
| InChIKey | WCBAZPKSUHCCHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2C(=O)NC(=O)N2)Br)F |
Computed by PubChem (NCBI)