CAS 1803900-95-9 is the registry number for Methyl 4-Bromo-2-fluoro-1H-1,3-benzodiazole-6-carboxylate. Offered by: TRC. Available pack sizes: 1g.
Methyl 7-bromo-2-fluoro-3H-benzimidazole-5-carboxylate (CAS 1803900-95-9) is a chemical compound with the molecular formula C9H6BrFN2O2 and a molecular weight of 273.06 g/mol. IUPAC name: methyl 7-bromo-2-fluoro-3H-benzimidazole-5-carboxylate. InChIKey: SKMQNIFSRXBODB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | methyl 7-bromo-2-fluoro-3H-benzimidazole-5-carboxylate |
| InChIKey | SKMQNIFSRXBODB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Br)N=C(N2)F |
Computed by PubChem (NCBI)