CAS 104622-26-6 is the registry number for 6-(Chloromethyl)-n-(2-phenylethyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-(chloromethyl)-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine (CAS 104622-26-6) is a chemical compound with the molecular formula C12H14ClN5 and a molecular weight of 263.72 g/mol. IUPAC name: 6-(chloromethyl)-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine. InChIKey: PUAOOCQSPNTZLI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN5 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 6-(chloromethyl)-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | PUAOOCQSPNTZLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC2=NC(=NC(=N2)N)CCl |
Computed by PubChem (NCBI)