CAS 108676-73-9 appears in our catalog under these names: 6-(Chloromethyl)-n-(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine, 95%, 6-(Chloromethyl)-N2-(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg.
6-(chloromethyl)-2-N-(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine (CAS 108676-73-9) is a chemical compound with the molecular formula C12H14ClN5 and a molecular weight of 263.72 g/mol. IUPAC name: 6-(chloromethyl)-2-N-(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: QDBAZCUDCLLWLI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN5 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 6-(chloromethyl)-2-N-(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | QDBAZCUDCLLWLI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC(=NC(=N2)N)CCl)C |
Computed by PubChem (NCBI)