CAS 1046463-50-6 is the registry number for 5-(3-Bromophenyl)-1H-pyrazole-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(3-bromophenyl)-1H-pyrazole-5-carbohydrazide (CAS 1046463-50-6) is a chemical compound with the molecular formula C10H9BrN4O and a molecular weight of 281.11 g/mol. IUPAC name: 3-(3-bromophenyl)-1H-pyrazole-5-carbohydrazide. InChIKey: FDZIFWMVWMXZPD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4O |
|---|---|
| Molecular weight | 281.11 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1H-pyrazole-5-carbohydrazide |
| InChIKey | FDZIFWMVWMXZPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NNC(=C2)C(=O)NN |
Computed by PubChem (NCBI)