CAS 1552887-22-5 is the registry number for 5-Amino-1-(2-bromophenyl)-1h-pyrazole-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-amino-1-(2-bromophenyl)pyrazole-4-carboxamide (CAS 1552887-22-5) is a chemical compound with the molecular formula C10H9BrN4O and a molecular weight of 281.11 g/mol. IUPAC name: 5-amino-1-(2-bromophenyl)pyrazole-4-carboxamide. InChIKey: HPIJZTWFGFMKGA-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4O |
|---|---|
| Molecular weight | 281.11 g/mol |
| IUPAC name | 5-amino-1-(2-bromophenyl)pyrazole-4-carboxamide |
| InChIKey | HPIJZTWFGFMKGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(C=N2)C(=O)N)N)Br |
Computed by PubChem (NCBI)