Products 104655-33-6

CAS 104655-33-6 is the registry number for Methyl 4-amino-3-hydroxy-2-naphthoate 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-hydroxynaphthalene-2-carboxylate (CAS 104655-33-6) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: methyl 4-amino-3-hydroxynaphthalene-2-carboxylate. InChIKey: XGJTYRCNXRHFJV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO3
Molecular weight217.22 g/mol
IUPAC namemethyl 4-amino-3-hydroxynaphthalene-2-carboxylate
InChIKeyXGJTYRCNXRHFJV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=CC=CC=C2C(=C1O)N

Computed by PubChem (NCBI)