CAS 1046788-71-9 appears in our catalog under these names: (2R,5S)-1,2,5-Trimethylpiperazine hydrochloride, 98%, (2R,5S)–1,2,5–Trimethylpiperazine hydrochloride, (2R,5S)-1,2,5-triMethylpiperazine hydrochloride, 95%, 95%, (2R,5S)-1,2,5-TRIMETHYLPIPERAZINE HCL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2R,5S)-1,2,5-trimethylpiperazine;hydrochloride (CAS 1046788-71-9) is a chemical compound with the molecular formula C7H17ClN2 and a molecular weight of 164.67 g/mol. IUPAC name: (2R,5S)-1,2,5-trimethylpiperazine;hydrochloride. InChIKey: HTJODMQOZCPIRR-UOERWJHTSA-N.
| Molecular formula | C7H17ClN2 |
|---|---|
| Molecular weight | 164.67 g/mol |
| IUPAC name | (2R,5S)-1,2,5-trimethylpiperazine;hydrochloride |
| InChIKey | HTJODMQOZCPIRR-UOERWJHTSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C)C.Cl |
Computed by PubChem (NCBI)