CAS 2245360-12-5 is the registry number for (3R,4S)-N,N,4-Trimethylpyrrolidin-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;hydrochloride (CAS 2245360-12-5) is a chemical compound with the molecular formula C7H17ClN2 and a molecular weight of 164.67 g/mol. IUPAC name: (3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;hydrochloride. InChIKey: XEDWPJAIGYLUPA-LEUCUCNGSA-N.
| Molecular formula | C7H17ClN2 |
|---|---|
| Molecular weight | 164.67 g/mol |
| IUPAC name | (3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;hydrochloride |
| InChIKey | XEDWPJAIGYLUPA-LEUCUCNGSA-N |
| SMILES | C[C@H]1CNC[C@@H]1N(C)C.Cl |
Computed by PubChem (NCBI)