CAS 104679-67-6 is the registry number for S 135. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5-methylthiophen-3-yl)-1H-pyrazolo[4,3-c]quinolin-3-one (CAS 104679-67-6) is a chemical compound with the molecular formula C15H11N3OS and a molecular weight of 281.3 g/mol. IUPAC name: 2-(5-methylthiophen-3-yl)-1H-pyrazolo[4,3-c]quinolin-3-one. InChIKey: WFXKQEFHXHUMSJ-UHFFFAOYSA-N.
| Molecular formula | C15H11N3OS |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2-(5-methylthiophen-3-yl)-1H-pyrazolo[4,3-c]quinolin-3-one |
| InChIKey | WFXKQEFHXHUMSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CS1)N2C(=O)C3=C(N2)C4=CC=CC=C4N=C3 |
Computed by PubChem (NCBI)