CAS 1448-64-2 is the registry number for 1-Benzoyl-3-(4-cyanophenyl)thiourea, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 1g, 5g.
N-[(4-cyanophenyl)carbamothioyl]benzamide (CAS 1448-64-2) is a chemical compound with the molecular formula C15H11N3OS and a molecular weight of 281.3 g/mol. IUPAC name: N-[(4-cyanophenyl)carbamothioyl]benzamide. InChIKey: FEECPKRZFPEEEU-UHFFFAOYSA-N.
| Molecular formula | C15H11N3OS |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | N-[(4-cyanophenyl)carbamothioyl]benzamide |
| InChIKey | FEECPKRZFPEEEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)