CAS 10470-83-4 appears in our catalog under these names: Quinoline-5,8-dione, 95%, 5,8–Quinolinequinone, 5,8-dihydroquinoline-5,8-dione, 5,8-Quinolinequinone 98%, Quinoline-5,8-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg, 1000mg, 500mg, 10g.
Quinoline-5,8-dione (CAS 10470-83-4) is a chemical compound with the molecular formula C9H5NO2 and a molecular weight of 159.14 g/mol. IUPAC name: quinoline-5,8-dione. InChIKey: NVJSPQCVDHGYRE-UHFFFAOYSA-N.
| Molecular formula | C9H5NO2 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | quinoline-5,8-dione |
| InChIKey | NVJSPQCVDHGYRE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=CC2=O)N=C1 |
Computed by PubChem (NCBI)