CAS 378751-64-5 appears in our catalog under these names: 3-Oxo-2,3-dihydrobenzofuran-5-carbonitrile, 95%, 3-Oxo-2,3-dihydrobenzofuran-5-carbonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-oxo-1-benzofuran-5-carbonitrile (CAS 378751-64-5) is a chemical compound with the molecular formula C9H5NO2 and a molecular weight of 159.14 g/mol. IUPAC name: 3-oxo-1-benzofuran-5-carbonitrile. InChIKey: FNZPUJQGNXXSME-UHFFFAOYSA-N.
| Molecular formula | C9H5NO2 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | 3-oxo-1-benzofuran-5-carbonitrile |
| InChIKey | FNZPUJQGNXXSME-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)