Products 1047620-84-7

CAS 1047620-84-7 is the registry number for 4-(1-Aminoethyl)-1,6-heptadien-4-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(1-aminoethyl)hepta-1,6-dien-4-ol;hydrochloride (CAS 1047620-84-7) is a chemical compound with the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. IUPAC name: 4-(1-aminoethyl)hepta-1,6-dien-4-ol;hydrochloride. InChIKey: MEDOFOOUSBXHJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO
Molecular weight191.70 g/mol
IUPAC name4-(1-aminoethyl)hepta-1,6-dien-4-ol;hydrochloride
InChIKeyMEDOFOOUSBXHJP-UHFFFAOYSA-N
SMILESCC(C(CC=C)(CC=C)O)N.Cl

Computed by PubChem (NCBI)