Products 1262774-50-4

CAS 1262774-50-4 is the registry number for 1-Isopropylpiperidine-4-carbaldehyde hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

1-propan-2-ylpiperidine-4-carbaldehyde;hydrochloride (CAS 1262774-50-4) is a chemical compound with the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. IUPAC name: 1-propan-2-ylpiperidine-4-carbaldehyde;hydrochloride. InChIKey: MSUVMAUWISTHON-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO
Molecular weight191.70 g/mol
IUPAC name1-propan-2-ylpiperidine-4-carbaldehyde;hydrochloride
InChIKeyMSUVMAUWISTHON-UHFFFAOYSA-N
SMILESCC(C)N1CCC(CC1)C=O.Cl

Computed by PubChem (NCBI)